C10H9BrClNO4 — CID 107833301
(2S)-3-[(3-bromo-2-chlorobenzoyl)amino]-2-hydroxypropanoic acid (PubChem CID 107833301) has the molecular formula C10H9BrClNO4 and a molecular weight of 322.54 g/mol. Its IUPAC name is (2S)-3-[(3-bromo-2-chlorobenzoyl)amino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[(3-bromo-2-chlorobenzoyl)amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107833301 |
| Molecular Formula | C10H9BrClNO4 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | (2S)-3-[(3-bromo-2-chlorobenzoyl)amino]-2-hydroxypropanoic acid |
| SMILES | O=C(NC[C@H](O)C(=O)O)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C10H9BrClNO4/c11-6-3-1-2-5(8(6)12)9(15)13-4-7(14)10(16)17/h1-3,7,14H,4H2,(H,13,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | FJKOCJPKDGAPHQ-ZETCQYMHSA-N |
| XLogP | 1.28 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |