C11H10ClF2NO3 — CID 103492785
methyl 2-chloro-3-[(3,5-difluorobenzoyl)amino]propanoate (PubChem CID 103492785) has the molecular formula C11H10ClF2NO3 and a molecular weight of 277.65 g/mol. Its IUPAC name is methyl 2-chloro-3-[(3,5-difluorobenzoyl)amino]propanoate.
| Compound Name | methyl 2-chloro-3-[(3,5-difluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 103492785 |
| Molecular Formula | C11H10ClF2NO3 |
| Molecular Weight | 277.65 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | methyl 2-chloro-3-[(3,5-difluorobenzoyl)amino]propanoate |
| SMILES | COC(=O)C(Cl)CNC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H10ClF2NO3/c1-18-11(17)9(12)5-15-10(16)6-2-7(13)4-8(14)3-6/h2-4,9H,5H2,1H3,(H,15,16) |
| InChIKey | OYZAJHVAXMWFKD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.65 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|