C12H16F2N2O — CID 120653813
N-[(2R)-2-(ethylamino)propyl]-3,5-difluorobenzamide (PubChem CID 120653813) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-3,5-difluorobenzamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 120653813 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-3,5-difluorobenzamide |
| SMILES | CCN[C@H](C)CNC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2N2O/c1-3-15-8(2)7-16-12(17)9-4-10(13)6-11(14)5-9/h4-6,8,15H,3,7H2,1-2H3,(H,16,17)/t8-/m1/s1 |
| InChIKey | WEOYRSKYGCSYFD-MRVPVSSYSA-N |
| XLogP | 1.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |