C11H18BrCl2N3O — CID 120653060
5-bromo-N-[(2R)-2-(ethylamino)propyl]pyridine-3-carboxamide;dihydrochloride (PubChem CID 120653060) has the molecular formula C11H18BrCl2N3O and a molecular weight of 359.10 g/mol. Its IUPAC name is 5-bromo-N-[(2R)-2-(ethylamino)propyl]pyridine-3-carboxamide;dihydrochloride.
| Compound Name | 5-bromo-N-[(2R)-2-(ethylamino)propyl]pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120653060 |
| Molecular Formula | C11H18BrCl2N3O |
| Molecular Weight | 359.10 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 5-bromo-N-[(2R)-2-(ethylamino)propyl]pyridine-3-carboxamide;dihydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)c1cncc(Br)c1.Cl.Cl |
| InChI | InChI=1S/C11H16BrN3O.2ClH/c1-3-14-8(2)5-15-11(16)9-4-10(12)7-13-6-9;;/h4,6-8,14H,3,5H2,1-2H3,(H,15,16);2*1H/t8-;;/m1../s1 |
| InChIKey | QLVALHOTRSQNMT-YCBDHFTFSA-N |
| XLogP | 2.42 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.10 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |