C14H18BrF2NO — CID 106255574
N-[2-(bromomethyl)-2-ethylbutyl]-2,4-difluorobenzamide (PubChem CID 106255574) has the molecular formula C14H18BrF2NO and a molecular weight of 334.20 g/mol. Its IUPAC name is N-[2-(bromomethyl)-2-ethylbutyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-(bromomethyl)-2-ethylbutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 106255574 |
| Molecular Formula | C14H18BrF2NO |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-[2-(bromomethyl)-2-ethylbutyl]-2,4-difluorobenzamide |
| SMILES | CCC(CC)(CBr)CNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H18BrF2NO/c1-3-14(4-2,8-15)9-18-13(19)11-6-5-10(16)7-12(11)17/h5-7H,3-4,8-9H2,1-2H3,(H,18,19) |
| InChIKey | MKLQHVYTNWBOKZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|