C11H12BrF2NO — CID 114308135
N-(1-bromo-2-methylpropan-2-yl)-2,4-difluorobenzamide (PubChem CID 114308135) has the molecular formula C11H12BrF2NO and a molecular weight of 292.12 g/mol. Its IUPAC name is N-(1-bromo-2-methylpropan-2-yl)-2,4-difluorobenzamide.
| Compound Name | N-(1-bromo-2-methylpropan-2-yl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 114308135 |
| Molecular Formula | C11H12BrF2NO |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | N-(1-bromo-2-methylpropan-2-yl)-2,4-difluorobenzamide |
| SMILES | CC(C)(CBr)NC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H12BrF2NO/c1-11(2,6-12)15-10(16)8-4-3-7(13)5-9(8)14/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | SYGOYQQYGHYYTD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|