C16H23F2NO2 — CID 70119044
2,4-difluoro-N-(2-methyl-1-pentoxypropan-2-yl)benzamide (PubChem CID 70119044) has the molecular formula C16H23F2NO2 and a molecular weight of 299.36 g/mol. Its IUPAC name is 2,4-difluoro-N-(2-methyl-1-pentoxypropan-2-yl)benzamide.
| Compound Name | 2,4-difluoro-N-(2-methyl-1-pentoxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 70119044 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2,4-difluoro-N-(2-methyl-1-pentoxypropan-2-yl)benzamide |
| SMILES | CCCCCOCC(C)(C)NC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2NO2/c1-4-5-6-9-21-11-16(2,3)19-15(20)13-8-7-12(17)10-14(13)18/h7-8,10H,4-6,9,11H2,1-3H3,(H,19,20) |
| InChIKey | FSBCOJBLWOUUGE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|