C14H20F2O3 — CID 70193274
2-(2,4-difluorophenyl)-3-pentoxypropane-1,2-diol (PubChem CID 70193274) has the molecular formula C14H20F2O3 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3-pentoxypropane-1,2-diol.
| Compound Name | 2-(2,4-difluorophenyl)-3-pentoxypropane-1,2-diol |
|---|---|
| PubChem CID | 70193274 |
| Molecular Formula | C14H20F2O3 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3-pentoxypropane-1,2-diol |
| SMILES | CCCCCOCC(O)(CO)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H20F2O3/c1-2-3-4-7-19-10-14(18,9-17)12-6-5-11(15)8-13(12)16/h5-6,8,17-18H,2-4,7,9-10H2,1H3 |
| InChIKey | BNHGPPKTJZHMNG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|