C34H37F2N3O4 — CID 71491340
(E)-1-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]-3-(4-octoxyphenyl)prop-2-en-1-one (PubChem CID 71491340) has the molecular formula C34H37F2N3O4 and a molecular weight of 589.68 g/mol. Its IUPAC name is (E)-1-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]-3-(4-octoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]-3-(4-octoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71491340 |
| Molecular Formula | C34H37F2N3O4 |
| Molecular Weight | 589.68 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | (E)-1-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]-3-(4-octoxyphenyl)prop-2-en-1-one |
| SMILES | CCCCCCCCOc1ccc(/C=C/C(=O)c2ccc(OCC(O)(Cn3cncn3)c3ccc(F)cc3F)cc2)cc1 |
| InChI | InChI=1S/C34H37F2N3O4/c1-2-3-4-5-6-7-20-42-29-14-8-26(9-15-29)10-19-33(40)27-11-16-30(17-12-27)43-23-34(41,22-39-25-37-24-38-39)31-18-13-28(35)21-32(31)36/h8-19,21,24-25,41H,2-7,20,22-23H2,1H3/b19-10+ |
| InChIKey | BHMWFBJXOJIZHB-VXLYETTFSA-N |
| XLogP | 7.16 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.68 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|