C25H31F2N5O2 — CID 42623939
2-(2,4-difluorophenyl)-1-[4-(4-phenoxybutyl)piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 42623939) has the molecular formula C25H31F2N5O2 and a molecular weight of 471.55 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[4-(4-phenoxybutyl)piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[4-(4-phenoxybutyl)piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 42623939 |
| Molecular Formula | C25H31F2N5O2 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[4-(4-phenoxybutyl)piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(CN1CCN(CCCCOc2ccccc2)CC1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H31F2N5O2/c26-21-8-9-23(24(27)16-21)25(33,18-32-20-28-19-29-32)17-31-13-11-30(12-14-31)10-4-5-15-34-22-6-2-1-3-7-22/h1-3,6-9,16,19-20,33H,4-5,10-15,17-18H2 |
| InChIKey | STQAMEAEDCXALK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|