C23H24BrF2N5O2 — CID 46844035
1-[4-[(2-bromophenyl)methoxyimino]piperidin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 46844035) has the molecular formula C23H24BrF2N5O2 and a molecular weight of 520.38 g/mol. Its IUPAC name is 1-[4-[(2-bromophenyl)methoxyimino]piperidin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-[4-[(2-bromophenyl)methoxyimino]piperidin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 46844035 |
| Molecular Formula | C23H24BrF2N5O2 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | 1-[4-[(2-bromophenyl)methoxyimino]piperidin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(CN1CCC(=NOCc2ccccc2Br)CC1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H24BrF2N5O2/c24-21-4-2-1-3-17(21)12-33-29-19-7-9-30(10-8-19)13-23(32,14-31-16-27-15-28-31)20-6-5-18(25)11-22(20)26/h1-6,11,15-16,32H,7-10,12-14H2 |
| InChIKey | HLOCDYSFCSCTCF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|