C24H24F4N6O2S2 — CID 54205825
(2R)-2-(2,4-difluorophenyl)-4-[[(3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butyl]disulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 54205825) has the molecular formula C24H24F4N6O2S2 and a molecular weight of 568.62 g/mol. Its IUPAC name is (2R)-2-(2,4-difluorophenyl)-4-[[(3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butyl]disulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R)-2-(2,4-difluorophenyl)-4-[[(3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butyl]disulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 54205825 |
| Molecular Formula | C24H24F4N6O2S2 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | (2R)-2-(2,4-difluorophenyl)-4-[[(3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butyl]disulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | O[C@@](CCSSCC[C@](O)(Cn1cncn1)c1ccc(F)cc1F)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H24F4N6O2S2/c25-17-1-3-19(21(27)9-17)23(35,11-33-15-29-13-31-33)5-7-37-38-8-6-24(36,12-34-16-30-14-32-34)20-4-2-18(26)10-22(20)28/h1-4,9-10,13-16,35-36H,5-8,11-12H2/t23-,24-/m0/s1 |
| InChIKey | PSKCLFJLAVFDTI-ZEQRLZLVSA-N |
| XLogP | 4.06 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|