C16H23F2N3OSi — CID 11121337
2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-5-trimethylsilylpentan-2-ol (PubChem CID 11121337) has the molecular formula C16H23F2N3OSi and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-5-trimethylsilylpentan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-5-trimethylsilylpentan-2-ol |
|---|---|
| PubChem CID | 11121337 |
| Molecular Formula | C16H23F2N3OSi |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-5-trimethylsilylpentan-2-ol |
| SMILES | C[Si](C)(C)CCCC(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2N3OSi/c1-23(2,3)8-4-7-16(22,10-21-12-19-11-20-21)14-6-5-13(17)9-15(14)18/h5-6,9,11-12,22H,4,7-8,10H2,1-3H3 |
| InChIKey | KBKYNXFBFKZUIJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|