C18H16F3N3OSe — CID 171345060
2-(2,4-difluorophenyl)-1-[(3-fluorophenyl)methylselanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 171345060) has the molecular formula C18H16F3N3OSe and a molecular weight of 426.30 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[(3-fluorophenyl)methylselanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[(3-fluorophenyl)methylselanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 171345060 |
| Molecular Formula | C18H16F3N3OSe |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[(3-fluorophenyl)methylselanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(C[Se]Cc1cccc(F)c1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H16F3N3OSe/c19-14-3-1-2-13(6-14)8-26-10-18(25,9-24-12-22-11-23-24)16-5-4-15(20)7-17(16)21/h1-7,11-12,25H,8-10H2 |
| InChIKey | YPQIHRMGHHMFQG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|