C33H43ClF2N6O — CID 175409586
1-[4-[10-(6-chloroindol-1-yl)decyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 175409586) has the molecular formula C33H43ClF2N6O and a molecular weight of 613.20 g/mol. Its IUPAC name is 1-[4-[10-(6-chloroindol-1-yl)decyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-[4-[10-(6-chloroindol-1-yl)decyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 175409586 |
| Molecular Formula | C33H43ClF2N6O |
| Molecular Weight | 613.20 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | 1-[4-[10-(6-chloroindol-1-yl)decyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(CN1CCN(CCCCCCCCCCn2ccc3ccc(Cl)cc32)CC1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C33H43ClF2N6O/c34-28-10-9-27-13-16-41(32(27)21-28)15-8-6-4-2-1-3-5-7-14-39-17-19-40(20-18-39)23-33(43,24-42-26-37-25-38-42)30-12-11-29(35)22-31(30)36/h9-13,16,21-22,25-26,43H,1-8,14-15,17-20,23-24H2 |
| InChIKey | XPKMLLHHVFFDSR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 62.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.20 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|