C27H32F2N8O2 — CID 56930763
2-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-4-(4-methylphenyl)-1,2,4-triazol-3-one (PubChem CID 56930763) has the molecular formula C27H32F2N8O2 and a molecular weight of 538.60 g/mol. Its IUPAC name is 2-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-4-(4-methylphenyl)-1,2,4-triazol-3-one.
| Compound Name | 2-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-4-(4-methylphenyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 56930763 |
| Molecular Formula | C27H32F2N8O2 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 2-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-4-(4-methylphenyl)-1,2,4-triazol-3-one |
| SMILES | Cc1ccc(-n2cnn(CCCN3CCN(CC(O)(Cn4cncn4)c4ccc(F)cc4F)CC3)c2=O)cc1 |
| InChI | InChI=1S/C27H32F2N8O2/c1-21-3-6-23(7-4-21)36-20-32-37(26(36)38)10-2-9-33-11-13-34(14-12-33)16-27(39,17-35-19-30-18-31-35)24-8-5-22(28)15-25(24)29/h3-8,15,18-20,39H,2,9-14,16-17H2,1H3 |
| InChIKey | AKLYWHVGRUOBQF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 97.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |