C20H17F3N6O2 — CID 10836380
2-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-(4-fluorophenyl)-1,2,4-triazol-3-one (PubChem CID 10836380) has the molecular formula C20H17F3N6O2 and a molecular weight of 430.39 g/mol. Its IUPAC name is 2-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-(4-fluorophenyl)-1,2,4-triazol-3-one.
| Compound Name | 2-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-(4-fluorophenyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 10836380 |
| Molecular Formula | C20H17F3N6O2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-(4-fluorophenyl)-1,2,4-triazol-3-one |
| SMILES | C[C@@H](n1ncn(-c2ccc(F)cc2)c1=O)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H17F3N6O2/c1-13(29-19(30)28(12-26-29)16-5-2-14(21)3-6-16)20(31,9-27-11-24-10-25-27)17-7-4-15(22)8-18(17)23/h2-8,10-13,31H,9H2,1H3/t13-,20-/m1/s1 |
| InChIKey | SDZYSVLNSMZSDW-ZUOKHONESA-N |
| XLogP | 2.19 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |