C28H34F2N8O4S — CID 18659259
2-butan-2-yl-4-[4-[4-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfonylpiperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 18659259) has the molecular formula C28H34F2N8O4S and a molecular weight of 616.70 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfonylpiperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfonylpiperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 18659259 |
| Molecular Formula | C28H34F2N8O4S |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfonylpiperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(S(=O)(=O)[C@H](C)[C@](O)(Cn4cncn4)c4ccc(F)cc4F)CC3)cc2)c1=O |
| InChI | InChI=1S/C28H34F2N8O4S/c1-4-20(2)38-27(39)37(19-33-38)24-8-6-23(7-9-24)34-11-13-36(14-12-34)43(41,42)21(3)28(40,16-35-18-31-17-32-35)25-10-5-22(29)15-26(25)30/h5-10,15,17-21,40H,4,11-14,16H2,1-3H3/t20?,21-,28-/m1/s1 |
| InChIKey | QWEUMYRZBXNCRK-XRDBWGCYSA-N |
| XLogP | 2.30 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|