C30H29ClF2N8OS — CID 10282649
4-[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]-2-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-1,2,4-triazole-3-thione (PubChem CID 10282649) has the molecular formula C30H29ClF2N8OS and a molecular weight of 623.13 g/mol. Its IUPAC name is 4-[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]-2-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-1,2,4-triazole-3-thione.
| Compound Name | 4-[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]-2-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 10282649 |
| Molecular Formula | C30H29ClF2N8OS |
| Molecular Weight | 623.13 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | 4-[4-[4-(4-chlorophenyl)piperazin-1-yl]phenyl]-2-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-1,2,4-triazole-3-thione |
| SMILES | CC(n1ncn(-c2ccc(N3CCN(c4ccc(Cl)cc4)CC3)cc2)c1=S)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C30H29ClF2N8OS/c1-21(30(42,17-39-19-34-18-35-39)27-11-4-23(32)16-28(27)33)41-29(43)40(20-36-41)26-9-7-25(8-10-26)38-14-12-37(13-15-38)24-5-2-22(31)3-6-24/h2-11,16,18-21,42H,12-15,17H2,1H3 |
| InChIKey | NUDBRIGYRALUSW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 80.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.13 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|