C31H29F5N8O2 — CID 10122185
2-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 10122185) has the molecular formula C31H29F5N8O2 and a molecular weight of 640.62 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 10122185 |
| Molecular Formula | C31H29F5N8O2 |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | 2-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-4-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CC(n1ncn(-c2ccc(N3CCN(c4ccc(C(F)(F)F)cc4)CC3)cc2)c1=O)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C31H29F5N8O2/c1-21(30(46,17-42-19-37-18-38-42)27-11-4-23(32)16-28(27)33)44-29(45)43(20-39-44)26-9-7-25(8-10-26)41-14-12-40(13-15-41)24-5-2-22(3-6-24)31(34,35)36/h2-11,16,18-21,46H,12-15,17H2,1H3 |
| InChIKey | HFIBRLNLMCTBHF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 97.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|