C32H34F2N8O3 — CID 20638419
4-[4-[4-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]piperazin-1-yl]phenyl]-2-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-one (PubChem CID 20638419) has the molecular formula C32H34F2N8O3 and a molecular weight of 616.67 g/mol. Its IUPAC name is 4-[4-[4-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]piperazin-1-yl]phenyl]-2-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]piperazin-1-yl]phenyl]-2-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 20638419 |
| Molecular Formula | C32H34F2N8O3 |
| Molecular Weight | 616.67 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | 4-[4-[4-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]piperazin-1-yl]phenyl]-2-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-one |
| SMILES | COc1ccc(Cn2ncn(-c3ccc(N4CCN([C@H](C)[C@](O)(Cn5cncn5)c5ccc(F)cc5F)CC4)cc3)c2=O)cc1 |
| InChI | InChI=1S/C32H34F2N8O3/c1-23(32(44,19-40-21-35-20-36-40)29-12-5-25(33)17-30(29)34)38-13-15-39(16-14-38)26-6-8-27(9-7-26)41-22-37-42(31(41)43)18-24-3-10-28(45-2)11-4-24/h3-12,17,20-23,44H,13-16,18-19H2,1-2H3/t23-,32-/m1/s1 |
| InChIKey | RPRRSVKSRLGERE-JIYROHSKSA-N |
| XLogP | 3.06 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|