C37H40F2N10O3 — CID 70194931
3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-7-[4-[4-(5-oxo-1-pentan-3-yl-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]quinazolin-4-one (PubChem CID 70194931) has the molecular formula C37H40F2N10O3 and a molecular weight of 710.79 g/mol. Its IUPAC name is 3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-7-[4-[4-(5-oxo-1-pentan-3-yl-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-7-[4-[4-(5-oxo-1-pentan-3-yl-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 70194931 |
| Molecular Formula | C37H40F2N10O3 |
| Molecular Weight | 710.79 g/mol |
| Exact Mass | 710.33 |
| IUPAC Name | 3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-7-[4-[4-(5-oxo-1-pentan-3-yl-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]quinazolin-4-one |
| SMILES | CCC(CC)n1ncn(-c2ccc(N3CCN(c4ccc5c(=O)n(C(C)C(O)(Cn6cncn6)c6ccc(F)cc6F)cnc5c4)CC3)cc2)c1=O |
| InChI | InChI=1S/C37H40F2N10O3/c1-4-27(5-2)49-36(51)48(24-43-49)29-9-7-28(8-10-29)44-14-16-45(17-15-44)30-11-12-31-34(19-30)41-23-47(35(31)50)25(3)37(52,20-46-22-40-21-42-46)32-13-6-26(38)18-33(32)39/h6-13,18-19,21-25,27,52H,4-5,14-17,20H2,1-3H3 |
| InChIKey | JQPKVRFNRGZASI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|