C24H24F5N3O3 — CID 44572080
(2R,3S)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)-4-[2-[4-(trifluoromethyl)phenyl]-1,3-dioxan-5-yl]butan-2-ol (PubChem CID 44572080) has the molecular formula C24H24F5N3O3 and a molecular weight of 497.46 g/mol. Its IUPAC name is (2R,3S)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)-4-[2-[4-(trifluoromethyl)phenyl]-1,3-dioxan-5-yl]butan-2-ol.
| Compound Name | (2R,3S)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)-4-[2-[4-(trifluoromethyl)phenyl]-1,3-dioxan-5-yl]butan-2-ol |
|---|---|
| PubChem CID | 44572080 |
| Molecular Formula | C24H24F5N3O3 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | (2R,3S)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)-4-[2-[4-(trifluoromethyl)phenyl]-1,3-dioxan-5-yl]butan-2-ol |
| SMILES | C[C@@H](CC1COC(c2ccc(C(F)(F)F)cc2)OC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H24F5N3O3/c1-15(23(33,12-32-14-30-13-31-32)20-7-6-19(25)9-21(20)26)8-16-10-34-22(35-11-16)17-2-4-18(5-3-17)24(27,28)29/h2-7,9,13-16,22,33H,8,10-12H2,1H3/t15-,16?,22?,23+/m0/s1 |
| InChIKey | ZBXMGXVFDUNSIB-HSQWHVRASA-N |
| XLogP | 4.85 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |