C30H30F2N4O4S — CID 44572454
4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-(4-methylphenyl)benzamide (PubChem CID 44572454) has the molecular formula C30H30F2N4O4S and a molecular weight of 580.66 g/mol. Its IUPAC name is 4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-(4-methylphenyl)benzamide.
| Compound Name | 4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 44572454 |
| Molecular Formula | C30H30F2N4O4S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(C3OCC(S[C@H](C)[C@](O)(Cn4cncn4)c4ccc(F)cc4F)CO3)cc2)cc1 |
| InChI | InChI=1S/C30H30F2N4O4S/c1-19-3-10-24(11-4-19)35-28(37)21-5-7-22(8-6-21)29-39-14-25(15-40-29)41-20(2)30(38,16-36-18-33-17-34-36)26-12-9-23(31)13-27(26)32/h3-13,17-18,20,25,29,38H,14-16H2,1-2H3,(H,35,37)/t20-,25?,29?,30-/m1/s1 |
| InChIKey | ROYSKFXIQQQAIZ-JCWYOLGFSA-N |
| XLogP | 5.24 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |