C25H27F2N3O3S2 — CID 10768273
(2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(E)-2-(4-methylsulfanylphenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 10768273) has the molecular formula C25H27F2N3O3S2 and a molecular weight of 519.64 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(E)-2-(4-methylsulfanylphenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(E)-2-(4-methylsulfanylphenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 10768273 |
| Molecular Formula | C25H27F2N3O3S2 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(E)-2-(4-methylsulfanylphenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CSc1ccc(/C=C/C2OCC(S[C@H](C)[C@](O)(Cn3cncn3)c3ccc(F)cc3F)CO2)cc1 |
| InChI | InChI=1S/C25H27F2N3O3S2/c1-17(25(31,14-30-16-28-15-29-30)22-9-6-19(26)11-23(22)27)35-21-12-32-24(33-13-21)10-5-18-3-7-20(34-2)8-4-18/h3-11,15-17,21,24,31H,12-14H2,1-2H3/b10-5+/t17-,21?,24?,25-/m1/s1 |
| InChIKey | SOEVUVVMRBOLQI-RFRRWNKKSA-N |
| XLogP | 4.74 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |