C25H24F5N3O3S2 — CID 10579006
(2R,3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[2-[(E)-2-[4-(trifluoromethylsulfanyl)phenyl]ethenyl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol (PubChem CID 10579006) has the molecular formula C25H24F5N3O3S2 and a molecular weight of 573.61 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[2-[(E)-2-[4-(trifluoromethylsulfanyl)phenyl]ethenyl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[2-[(E)-2-[4-(trifluoromethylsulfanyl)phenyl]ethenyl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol |
|---|---|
| PubChem CID | 10579006 |
| Molecular Formula | C25H24F5N3O3S2 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[2-[(E)-2-[4-(trifluoromethylsulfanyl)phenyl]ethenyl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol |
| SMILES | C[C@@H](SC1COC(/C=C/c2ccc(SC(F)(F)F)cc2)OC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H24F5N3O3S2/c1-16(24(34,13-33-15-31-14-32-33)21-8-5-18(26)10-22(21)27)37-20-11-35-23(36-12-20)9-4-17-2-6-19(7-3-17)38-25(28,29)30/h2-10,14-16,20,23,34H,11-13H2,1H3/b9-4+/t16-,20?,23?,24-/m1/s1 |
| InChIKey | LNGLLPZFFYXGKM-PLEUPMGASA-N |
| XLogP | 5.63 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |