C27H26F5N3O4S2 — CID 18363281
2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[2-[(1E,3E)-4-[4-(trifluoromethylsulfinyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol (PubChem CID 18363281) has the molecular formula C27H26F5N3O4S2 and a molecular weight of 615.65 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[2-[(1E,3E)-4-[4-(trifluoromethylsulfinyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[2-[(1E,3E)-4-[4-(trifluoromethylsulfinyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol |
|---|---|
| PubChem CID | 18363281 |
| Molecular Formula | C27H26F5N3O4S2 |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 615.13 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[2-[(1E,3E)-4-[4-(trifluoromethylsulfinyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]butan-2-ol |
| SMILES | CC(SC1COC(/C=C/C=C/c2ccc(S(=O)C(F)(F)F)cc2)OC1)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C27H26F5N3O4S2/c1-18(26(36,15-35-17-33-16-34-35)23-11-8-20(28)12-24(23)29)40-21-13-38-25(39-14-21)5-3-2-4-19-6-9-22(10-7-19)41(37)27(30,31)32/h2-12,16-18,21,25,36H,13-15H2,1H3/b4-2+,5-3+ |
| InChIKey | ALSVCWPVZWQNQT-ZUVMSYQZSA-N |
| XLogP | 5.20 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|