C26H27ClF2N3O3P — CID 16683929
(2R,3R)-3-[[2-[(1E,3E)-4-(4-chlorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]phosphanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 16683929) has the molecular formula C26H27ClF2N3O3P and a molecular weight of 533.94 g/mol. Its IUPAC name is (2R,3R)-3-[[2-[(1E,3E)-4-(4-chlorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]phosphanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-3-[[2-[(1E,3E)-4-(4-chlorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]phosphanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 16683929 |
| Molecular Formula | C26H27ClF2N3O3P |
| Molecular Weight | 533.94 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | (2R,3R)-3-[[2-[(1E,3E)-4-(4-chlorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]phosphanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](PC1COC(/C=C/C=C/c2ccc(Cl)cc2)OC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C26H27ClF2N3O3P/c1-18(26(33,15-32-17-30-16-31-32)23-11-10-21(28)12-24(23)29)36-22-13-34-25(35-14-22)5-3-2-4-19-6-8-20(27)9-7-19/h2-12,16-18,22,25,33,36H,13-15H2,1H3/b4-2+,5-3+/t18-,22?,25?,26-/m1/s1 |
| InChIKey | BUVXUEZZQWTRJQ-HKCZVQAFSA-N |
| XLogP | 5.18 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.94 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|