C27H26F6N3O3P — CID 16683932
(2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(1E,3E)-4-[2-fluoro-4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]phosphanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 16683932) has the molecular formula C27H26F6N3O3P and a molecular weight of 585.49 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(1E,3E)-4-[2-fluoro-4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]phosphanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(1E,3E)-4-[2-fluoro-4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]phosphanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 16683932 |
| Molecular Formula | C27H26F6N3O3P |
| Molecular Weight | 585.49 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(1E,3E)-4-[2-fluoro-4-(trifluoromethyl)phenyl]buta-1,3-dienyl]-1,3-dioxan-5-yl]phosphanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](PC1COC(/C=C/C=C/c2ccc(C(F)(F)F)cc2F)OC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C27H26F6N3O3P/c1-17(26(37,14-36-16-34-15-35-36)22-9-8-20(28)11-24(22)30)40-21-12-38-25(39-13-21)5-3-2-4-18-6-7-19(10-23(18)29)27(31,32)33/h2-11,15-17,21,25,37,40H,12-14H2,1H3/b4-2+,5-3+/t17-,21?,25?,26-/m1/s1 |
| InChIKey | SYJNQQPYTFYTDG-LTWXUGGQSA-N |
| XLogP | 5.68 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|