C27H25F3N4O3S — CID 154082144
4-[4-[5-[(2R,3R)-3-(2,5-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]buta-1,3-dienyl]-3-fluorobenzonitrile (PubChem CID 154082144) has the molecular formula C27H25F3N4O3S and a molecular weight of 542.58 g/mol. Its IUPAC name is 4-[4-[5-[(2R,3R)-3-(2,5-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]buta-1,3-dienyl]-3-fluorobenzonitrile.
| Compound Name | 4-[4-[5-[(2R,3R)-3-(2,5-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]buta-1,3-dienyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 154082144 |
| Molecular Formula | C27H25F3N4O3S |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 4-[4-[5-[(2R,3R)-3-(2,5-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]buta-1,3-dienyl]-3-fluorobenzonitrile |
| SMILES | C[C@@H](SC1COC(C=CC=Cc2ccc(C#N)cc2F)OC1)[C@](O)(Cn1cncn1)c1cc(F)ccc1F |
| InChI | InChI=1S/C27H25F3N4O3S/c1-18(27(35,15-34-17-32-16-33-34)23-11-21(28)8-9-24(23)29)38-22-13-36-26(37-14-22)5-3-2-4-20-7-6-19(12-31)10-25(20)30/h2-11,16-18,22,26,35H,13-15H2,1H3/t18-,22?,26?,27-/m1/s1 |
| InChIKey | BNDFBQBWJJQQKT-CXPLVSQOSA-N |
| XLogP | 4.59 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|