C27H25F3N4NaO6PS — CID 21336687
sodium [3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] hydrogen phosphate (PubChem CID 21336687) has the molecular formula C27H25F3N4NaO6PS and a molecular weight of 644.54 g/mol. Its IUPAC name is sodium [3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] hydrogen phosphate.
| Compound Name | sodium [3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 21336687 |
| Molecular Formula | C27H25F3N4NaO6PS |
| Molecular Weight | 644.54 g/mol |
| Exact Mass | 644.11 |
| IUPAC Name | sodium [3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] hydrogen phosphate |
| SMILES | CC(SC1COC(/C=C/C=C/c2ccc(C#N)cc2F)OC1)C(Cn1cncn1)(OP(=O)([O-])O)c1ccc(F)cc1F.[Na+] |
| InChI | InChI=1S/C27H26F3N4O6PS.Na/c1-18(27(40-41(35,36)37,15-34-17-32-16-33-34)23-9-8-21(28)11-25(23)30)42-22-13-38-26(39-14-22)5-3-2-4-20-7-6-19(12-31)10-24(20)29;/h2-11,16-18,22,26H,13-15H2,1H3,(H2,35,36,37);/q;+1/p-1/b4-2+,5-3+; |
| InChIKey | ZFDHNWHJHGTJNR-BJMABRHOSA-M |
| XLogP | 1.08 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.54 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|