C28H25F3N4O5S — CID 173142734
[3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] hydrogen carbonate (PubChem CID 173142734) has the molecular formula C28H25F3N4O5S and a molecular weight of 586.59 g/mol. Its IUPAC name is [3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] hydrogen carbonate.
| Compound Name | [3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 173142734 |
| Molecular Formula | C28H25F3N4O5S |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | [3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] hydrogen carbonate |
| SMILES | CC(SC1COC(C=CC=Cc2ccc(C#N)cc2F)OC1)C(Cn1cncn1)(OC(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H25F3N4O5S/c1-18(28(40-27(36)37,15-35-17-33-16-34-35)23-9-8-21(29)11-25(23)31)41-22-13-38-26(39-14-22)5-3-2-4-20-7-6-19(12-32)10-24(20)30/h2-11,16-18,22,26H,13-15H2,1H3,(H,36,37) |
| InChIKey | YUQMZUBPAKLTMS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|