C35H30F4N4O4S — CID 173144959
[(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 5-fluoro-2-methylbenzoate (PubChem CID 173144959) has the molecular formula C35H30F4N4O4S and a molecular weight of 678.71 g/mol. Its IUPAC name is [(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 5-fluoro-2-methylbenzoate.
| Compound Name | [(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 5-fluoro-2-methylbenzoate |
|---|---|
| PubChem CID | 173144959 |
| Molecular Formula | C35H30F4N4O4S |
| Molecular Weight | 678.71 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | [(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 5-fluoro-2-methylbenzoate |
| SMILES | Cc1ccc(F)cc1C(=O)O[C@@](Cn1cncn1)(c1ccc(F)cc1F)[C@@H](C)SC1COC(/C=C/C=C/c2ccc(C#N)cc2F)OC1 |
| InChI | InChI=1S/C35H30F4N4O4S/c1-22-7-10-26(36)14-29(22)34(44)47-35(19-43-21-41-20-42-43,30-12-11-27(37)15-32(30)39)23(2)48-28-17-45-33(46-18-28)6-4-3-5-25-9-8-24(16-40)13-31(25)38/h3-15,20-21,23,28,33H,17-19H2,1-2H3/b5-3+,6-4+/t23-,28?,33?,35-/m1/s1 |
| InChIKey | IRSCMFOIOQXVCQ-BDSLAAAISA-N |
| XLogP | 6.90 |
| TPSA | 99.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.71 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|