C30H28ClF3N4O5S — CID 58885362
2-chloroethyl [(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] carbonate (PubChem CID 58885362) has the molecular formula C30H28ClF3N4O5S and a molecular weight of 649.09 g/mol. Its IUPAC name is 2-chloroethyl [(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] carbonate.
| Compound Name | 2-chloroethyl [(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] carbonate |
|---|---|
| PubChem CID | 58885362 |
| Molecular Formula | C30H28ClF3N4O5S |
| Molecular Weight | 649.09 g/mol |
| Exact Mass | 648.14 |
| IUPAC Name | 2-chloroethyl [(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] carbonate |
| SMILES | C[C@@H](SC1COC(/C=C/C=C/c2ccc(C#N)cc2F)OC1)[C@@](Cn1cncn1)(OC(=O)OCCCl)c1ccc(F)cc1F |
| InChI | InChI=1S/C30H28ClF3N4O5S/c1-20(44-24-15-41-28(42-16-24)5-3-2-4-22-7-6-21(14-35)12-26(22)33)30(17-38-19-36-18-37-38,43-29(39)40-11-10-31)25-9-8-23(32)13-27(25)34/h2-9,12-13,18-20,24,28H,10-11,15-17H2,1H3/b4-2+,5-3+/t20-,24?,28?,30-/m1/s1 |
| InChIKey | SXNDDKZPDBHKIB-OLCHJEDUSA-N |
| XLogP | 5.99 |
| TPSA | 108.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.09 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|