C33H33F3N4O6S — CID 58885321
[(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 4-acetyloxybutanoate (PubChem CID 58885321) has the molecular formula C33H33F3N4O6S and a molecular weight of 670.71 g/mol. Its IUPAC name is [(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 4-acetyloxybutanoate.
| Compound Name | [(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 4-acetyloxybutanoate |
|---|---|
| PubChem CID | 58885321 |
| Molecular Formula | C33H33F3N4O6S |
| Molecular Weight | 670.71 g/mol |
| Exact Mass | 670.21 |
| IUPAC Name | [(2R,3R)-3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 4-acetyloxybutanoate |
| SMILES | CC(=O)OCCCC(=O)O[C@@](Cn1cncn1)(c1ccc(F)cc1F)[C@@H](C)SC1COC(/C=C/C=C/c2ccc(C#N)cc2F)OC1 |
| InChI | InChI=1S/C33H33F3N4O6S/c1-22(47-27-17-44-32(45-18-27)8-4-3-6-25-10-9-24(16-37)14-29(25)35)33(19-40-21-38-20-39-40,28-12-11-26(34)15-30(28)36)46-31(42)7-5-13-43-23(2)41/h3-4,6,8-12,14-15,20-22,27,32H,5,7,13,17-19H2,1-2H3/b6-3+,8-4+/t22-,27?,32?,33-/m1/s1 |
| InChIKey | RZQQLLMARWLFQC-CIORWXDTSA-N |
| XLogP | 5.48 |
| TPSA | 125.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.71 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|