C29H27F3N4O4S — CID 21336690
[3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] acetate (PubChem CID 21336690) has the molecular formula C29H27F3N4O4S and a molecular weight of 584.62 g/mol. Its IUPAC name is [3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] acetate.
| Compound Name | [3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] acetate |
|---|---|
| PubChem CID | 21336690 |
| Molecular Formula | C29H27F3N4O4S |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | [3-[[2-[(1E,3E)-4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] acetate |
| SMILES | CC(=O)OC(Cn1cncn1)(c1ccc(F)cc1F)C(C)SC1COC(/C=C/C=C/c2ccc(C#N)cc2F)OC1 |
| InChI | InChI=1S/C29H27F3N4O4S/c1-19(29(40-20(2)37,16-36-18-34-17-35-36)25-10-9-23(30)12-27(25)32)41-24-14-38-28(39-15-24)6-4-3-5-22-8-7-21(13-33)11-26(22)31/h3-12,17-19,24,28H,14-16H2,1-2H3/b5-3+,6-4+ |
| InChIKey | UKCLCBWFSGFOKE-GGWOSOGESA-N |
| XLogP | 5.16 |
| TPSA | 99.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|