C31H31F3N4O5S — CID 91187227
[(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 4-hydroxybutanoate (PubChem CID 91187227) has the molecular formula C31H31F3N4O5S and a molecular weight of 628.67 g/mol. Its IUPAC name is [(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 4-hydroxybutanoate.
| Compound Name | [(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 4-hydroxybutanoate |
|---|---|
| PubChem CID | 91187227 |
| Molecular Formula | C31H31F3N4O5S |
| Molecular Weight | 628.67 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | [(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 4-hydroxybutanoate |
| SMILES | C[C@@H](SC1COC(C=CC=Cc2ccc(C#N)cc2F)OC1)[C@@](Cn1cncn1)(OC(=O)CCCO)c1ccc(F)cc1F |
| InChI | InChI=1S/C31H31F3N4O5S/c1-21(44-25-16-41-30(42-17-25)7-3-2-5-23-9-8-22(15-35)13-27(23)33)31(18-38-20-36-19-37-38,43-29(40)6-4-12-39)26-11-10-24(32)14-28(26)34/h2-3,5,7-11,13-14,19-21,25,30,39H,4,6,12,16-18H2,1H3/t21-,25?,30?,31-/m1/s1 |
| InChIKey | DRZPSGNCYDOGPQ-WBLHDZFGSA-N |
| XLogP | 4.91 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|