C27H26F3N4O6PS — CID 173231561
[(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] dihydrogen phosphate (PubChem CID 173231561) has the molecular formula C27H26F3N4O6PS and a molecular weight of 622.56 g/mol. Its IUPAC name is [(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 173231561 |
| Molecular Formula | C27H26F3N4O6PS |
| Molecular Weight | 622.56 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | [(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] dihydrogen phosphate |
| SMILES | C[C@@H](SC1COC(C=CC=Cc2ccc(C#N)cc2F)OC1)[C@@](Cn1cncn1)(OP(=O)(O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C27H26F3N4O6PS/c1-18(27(40-41(35,36)37,15-34-17-32-16-33-34)23-9-8-21(28)11-25(23)30)42-22-13-38-26(39-14-22)5-3-2-4-20-7-6-19(12-31)10-24(20)29/h2-11,16-18,22,26H,13-15H2,1H3,(H2,35,36,37)/t18-,22?,26?,27-/m1/s1 |
| InChIKey | HDXQYFHZOTYZIJ-CXPLVSQOSA-N |
| XLogP | 4.70 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|