C27H27F3N4O5PS+ — CID 173269505
[(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]-trihydroxyphosphanium (PubChem CID 173269505) has the molecular formula C27H27F3N4O5PS+ and a molecular weight of 607.57 g/mol. Its IUPAC name is [(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]-trihydroxyphosphanium.
| Compound Name | [(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 173269505 |
| Molecular Formula | C27H27F3N4O5PS+ |
| Molecular Weight | 607.57 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | [(2R,3R)-3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]-trihydroxyphosphanium |
| SMILES | C[C@@H](SC1COC(C=CC=Cc2ccc(C#N)cc2F)OC1)[C@](Cn1cncn1)(c1ccc(F)cc1F)[P+](O)(O)O |
| InChI | InChI=1S/C27H27F3N4O5PS/c1-18(27(40(35,36)37,15-34-17-32-16-33-34)23-9-8-21(28)11-25(23)30)41-22-13-38-26(39-14-22)5-3-2-4-20-7-6-19(12-31)10-24(20)29/h2-11,16-18,22,26,35-37H,13-15H2,1H3/q+1/t18-,22?,26?,27-/m1/s1 |
| InChIKey | RSXYUEMGLCTKKT-CXPLVSQOSA-N |
| XLogP | 4.33 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|