C26H25F4N3O3S — CID 6481116
(2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(1E,3E)-4-(2,4-difluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 6481116) has the molecular formula C26H25F4N3O3S and a molecular weight of 535.56 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(1E,3E)-4-(2,4-difluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(1E,3E)-4-(2,4-difluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 6481116 |
| Molecular Formula | C26H25F4N3O3S |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[(1E,3E)-4-(2,4-difluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](SC1COC(/C=C/C=C/c2ccc(F)cc2F)OC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C26H25F4N3O3S/c1-17(26(34,14-33-16-31-15-32-33)22-9-8-20(28)11-24(22)30)37-21-12-35-25(36-13-21)5-3-2-4-18-6-7-19(27)10-23(18)29/h2-11,15-17,21,25,34H,12-14H2,1H3/b4-2+,5-3+/t17-,21?,25?,26-/m1/s1 |
| InChIKey | AWGDDNWXTCNKFI-LTWXUGGQSA-N |
| XLogP | 4.86 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|