C24H24F2N4O5S — CID 54397378
(2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[2-(4-nitrophenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 54397378) has the molecular formula C24H24F2N4O5S and a molecular weight of 518.54 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[2-(4-nitrophenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[2-(4-nitrophenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 54397378 |
| Molecular Formula | C24H24F2N4O5S |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[[2-[2-(4-nitrophenyl)ethenyl]-1,3-dioxan-5-yl]sulfanyl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](SC1COC(C=Cc2ccc([N+](=O)[O-])cc2)OC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H24F2N4O5S/c1-16(24(31,13-29-15-27-14-28-29)21-8-5-18(25)10-22(21)26)36-20-11-34-23(35-12-20)9-4-17-2-6-19(7-3-17)30(32)33/h2-10,14-16,20,23,31H,11-13H2,1H3/t16-,20?,23?,24-/m1/s1 |
| InChIKey | VKYMWJMSZAACCY-FXIICPIPSA-N |
| XLogP | 3.93 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|