C29H27F2N5O6S — CID 59098220
4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-(4-nitrophenyl)benzamide (PubChem CID 59098220) has the molecular formula C29H27F2N5O6S and a molecular weight of 611.63 g/mol. Its IUPAC name is 4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-(4-nitrophenyl)benzamide.
| Compound Name | 4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-(4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 59098220 |
| Molecular Formula | C29H27F2N5O6S |
| Molecular Weight | 611.63 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | 4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-(4-nitrophenyl)benzamide |
| SMILES | C[C@@H](SC1COC(c2ccc(C(=O)Nc3ccc([N+](=O)[O-])cc3)cc2)OC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C29H27F2N5O6S/c1-18(29(38,15-35-17-32-16-33-35)25-11-6-21(30)12-26(25)31)43-24-13-41-28(42-14-24)20-4-2-19(3-5-20)27(37)34-22-7-9-23(10-8-22)36(39)40/h2-12,16-18,24,28,38H,13-15H2,1H3,(H,34,37)/t18-,24?,28?,29-/m1/s1 |
| InChIKey | QHAXQMXTLCIYRQ-KEVQNJKISA-N |
| XLogP | 4.84 |
| TPSA | 141.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|