C30H26F3N5O4S — CID 44572460
N-(4-cyano-2-fluorophenyl)-4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]benzamide (PubChem CID 44572460) has the molecular formula C30H26F3N5O4S and a molecular weight of 609.63 g/mol. Its IUPAC name is N-(4-cyano-2-fluorophenyl)-4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]benzamide.
| Compound Name | N-(4-cyano-2-fluorophenyl)-4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]benzamide |
|---|---|
| PubChem CID | 44572460 |
| Molecular Formula | C30H26F3N5O4S |
| Molecular Weight | 609.63 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | N-(4-cyano-2-fluorophenyl)-4-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]benzamide |
| SMILES | C[C@@H](SC1COC(c2ccc(C(=O)Nc3ccc(C#N)cc3F)cc2)OC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C30H26F3N5O4S/c1-18(30(40,15-38-17-35-16-36-38)24-8-7-22(31)11-25(24)32)43-23-13-41-29(42-14-23)21-5-3-20(4-6-21)28(39)37-27-9-2-19(12-34)10-26(27)33/h2-11,16-18,23,29,40H,13-15H2,1H3,(H,37,39)/t18-,23?,29?,30-/m1/s1 |
| InChIKey | CDUVRZSCKHCOTG-OPTOBVFHSA-N |
| XLogP | 4.94 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |