C36H32F6N4O5S — CID 18766329
6-[5-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]naphthalene-2-carboxamide (PubChem CID 18766329) has the molecular formula C36H32F6N4O5S and a molecular weight of 746.73 g/mol. Its IUPAC name is 6-[5-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]naphthalene-2-carboxamide.
| Compound Name | 6-[5-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18766329 |
| Molecular Formula | C36H32F6N4O5S |
| Molecular Weight | 746.73 g/mol |
| Exact Mass | 746.20 |
| IUPAC Name | 6-[5-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]-N-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]naphthalene-2-carboxamide |
| SMILES | CC(SC1COC(c2ccc3cc(C(=O)Nc4ccc(OCC(F)(F)C(F)F)cc4)ccc3c2)OC1)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C36H32F6N4O5S/c1-21(35(48,17-46-20-43-19-44-46)30-11-6-26(37)14-31(30)38)52-29-15-49-33(50-16-29)25-5-3-22-12-24(4-2-23(22)13-25)32(47)45-27-7-9-28(10-8-27)51-18-36(41,42)34(39)40/h2-14,19-21,29,33-34,48H,15-18H2,1H3,(H,45,47) |
| InChIKey | AKXUOXQYXLAHDT-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.73 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|