C24H23F6N5O3 — CID 3003628
1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazolidin-2-one (PubChem CID 3003628) has the molecular formula C24H23F6N5O3 and a molecular weight of 543.47 g/mol. Its IUPAC name is 1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazolidin-2-one.
| Compound Name | 1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 3003628 |
| Molecular Formula | C24H23F6N5O3 |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | 1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazolidin-2-one |
| SMILES | C[C@@H](N1CCN(c2ccc(OCC(F)(F)C(F)F)cc2)C1=O)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H23F6N5O3/c1-15(23(37,11-33-14-31-13-32-33)19-7-2-16(25)10-20(19)26)34-8-9-35(22(34)36)17-3-5-18(6-4-17)38-12-24(29,30)21(27)28/h2-7,10,13-15,21,37H,8-9,11-12H2,1H3/t15-,23-/m1/s1 |
| InChIKey | MSGIBEYZNFFBOG-IQMFZBJNSA-N |
| XLogP | 4.05 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|