C24H24F5N5O3 — CID 54325617
1-[(2R,3R)-3-(4-fluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazolidin-2-one (PubChem CID 54325617) has the molecular formula C24H24F5N5O3 and a molecular weight of 525.48 g/mol. Its IUPAC name is 1-[(2R,3R)-3-(4-fluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazolidin-2-one.
| Compound Name | 1-[(2R,3R)-3-(4-fluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 54325617 |
| Molecular Formula | C24H24F5N5O3 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 1-[(2R,3R)-3-(4-fluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazolidin-2-one |
| SMILES | C[C@@H](N1CCN(c2ccc(OCC(F)(F)C(F)F)cc2)C1=O)[C@](O)(Cn1cncn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H24F5N5O3/c1-16(23(36,12-32-15-30-14-31-32)17-2-4-18(25)5-3-17)33-10-11-34(22(33)35)19-6-8-20(9-7-19)37-13-24(28,29)21(26)27/h2-9,14-16,21,36H,10-13H2,1H3/t16-,23-/m1/s1 |
| InChIKey | SURPCEKBJDWNSD-WAIKUNEKSA-N |
| XLogP | 3.91 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|