C17H15ClF7N3O2 — CID 162383841
1-[2-chloro-4-(2,2,3,3-tetrafluoropropoxy)phenyl]-2-(1,2,4-triazol-1-yl)-1-[1-(trifluoromethyl)cyclopropyl]ethanol (PubChem CID 162383841) has the molecular formula C17H15ClF7N3O2 and a molecular weight of 461.77 g/mol. Its IUPAC name is 1-[2-chloro-4-(2,2,3,3-tetrafluoropropoxy)phenyl]-2-(1,2,4-triazol-1-yl)-1-[1-(trifluoromethyl)cyclopropyl]ethanol.
| Compound Name | 1-[2-chloro-4-(2,2,3,3-tetrafluoropropoxy)phenyl]-2-(1,2,4-triazol-1-yl)-1-[1-(trifluoromethyl)cyclopropyl]ethanol |
|---|---|
| PubChem CID | 162383841 |
| Molecular Formula | C17H15ClF7N3O2 |
| Molecular Weight | 461.77 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 1-[2-chloro-4-(2,2,3,3-tetrafluoropropoxy)phenyl]-2-(1,2,4-triazol-1-yl)-1-[1-(trifluoromethyl)cyclopropyl]ethanol |
| SMILES | OC(Cn1cncn1)(c1ccc(OCC(F)(F)C(F)F)cc1Cl)C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H15ClF7N3O2/c18-12-5-10(30-7-16(21,22)13(19)20)1-2-11(12)15(29,6-28-9-26-8-27-28)14(3-4-14)17(23,24)25/h1-2,5,8-9,13,29H,3-4,6-7H2 |
| InChIKey | FZUYSPUAWXSDHA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.77 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|