C19H19Cl2N3O3 — CID 141295495
1-[2-chloro-4-(4-chlorophenoxy)phenyl]-1-propan-2-yloxy-2-(1,2,4-triazol-1-yl)ethanol (PubChem CID 141295495) has the molecular formula C19H19Cl2N3O3 and a molecular weight of 408.29 g/mol. Its IUPAC name is 1-[2-chloro-4-(4-chlorophenoxy)phenyl]-1-propan-2-yloxy-2-(1,2,4-triazol-1-yl)ethanol.
| Compound Name | 1-[2-chloro-4-(4-chlorophenoxy)phenyl]-1-propan-2-yloxy-2-(1,2,4-triazol-1-yl)ethanol |
|---|---|
| PubChem CID | 141295495 |
| Molecular Formula | C19H19Cl2N3O3 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 1-[2-chloro-4-(4-chlorophenoxy)phenyl]-1-propan-2-yloxy-2-(1,2,4-triazol-1-yl)ethanol |
| SMILES | CC(C)OC(O)(Cn1cncn1)c1ccc(Oc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C19H19Cl2N3O3/c1-13(2)27-19(25,10-24-12-22-11-23-24)17-8-7-16(9-18(17)21)26-15-5-3-14(20)4-6-15/h3-9,11-13,25H,10H2,1-2H3 |
| InChIKey | YEQXQKHVOQUSFW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|