C20H21Cl2N3O2 — CID 71258978
2-[2-chloro-4-(4-chlorophenoxy)phenyl]-1-(1,2,4-triazol-1-yl)hexan-2-ol (PubChem CID 71258978) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is 2-[2-chloro-4-(4-chlorophenoxy)phenyl]-1-(1,2,4-triazol-1-yl)hexan-2-ol.
| Compound Name | 2-[2-chloro-4-(4-chlorophenoxy)phenyl]-1-(1,2,4-triazol-1-yl)hexan-2-ol |
|---|---|
| PubChem CID | 71258978 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-[2-chloro-4-(4-chlorophenoxy)phenyl]-1-(1,2,4-triazol-1-yl)hexan-2-ol |
| SMILES | CCCCC(O)(Cn1cncn1)c1ccc(Oc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C20H21Cl2N3O2/c1-2-3-10-20(26,12-25-14-23-13-24-25)18-9-8-17(11-19(18)22)27-16-6-4-15(21)5-7-16/h4-9,11,13-14,26H,2-3,10,12H2,1H3 |
| InChIKey | HWJPIHOOVCZXGV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |