C24H30ClN3O2 — CID 57249725
2-[4-(4-chlorophenoxy)phenyl]-1-(1,2,4-triazol-1-yl)decan-2-ol (PubChem CID 57249725) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)phenyl]-1-(1,2,4-triazol-1-yl)decan-2-ol.
| Compound Name | 2-[4-(4-chlorophenoxy)phenyl]-1-(1,2,4-triazol-1-yl)decan-2-ol |
|---|---|
| PubChem CID | 57249725 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)phenyl]-1-(1,2,4-triazol-1-yl)decan-2-ol |
| SMILES | CCCCCCCCC(O)(Cn1cncn1)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H30ClN3O2/c1-2-3-4-5-6-7-16-24(29,17-28-19-26-18-27-28)20-8-12-22(13-9-20)30-23-14-10-21(25)11-15-23/h8-15,18-19,29H,2-7,16-17H2,1H3 |
| InChIKey | YLSTVGDQFTXELT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|